C18H21N3O2 — CID 97377284
[(4aR,7aR)-1-(pyridin-2-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone (PubChem CID 97377284) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is [(4aR,7aR)-1-(pyridin-2-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone.
| Compound Name | [(4aR,7aR)-1-(pyridin-2-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97377284 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [(4aR,7aR)-1-(pyridin-2-ylmethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1C[C@H]2CCCN(Cc3ccccn3)[C@H]2C1 |
| InChI | InChI=1S/C18H21N3O2/c22-18(17-7-4-10-23-17)21-11-14-5-3-9-20(16(14)13-21)12-15-6-1-2-8-19-15/h1-2,4,6-8,10,14,16H,3,5,9,11-13H2/t14-,16+/m1/s1 |
| InChIKey | RNWRWZNSWKDLHQ-ZBFHGGJFSA-N |
| XLogP | 2.41 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |