C16H17N3O3 — CID 110807707
[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-pyridin-2-ylmethanone (PubChem CID 110807707) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110807707 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C16H17N3O3/c20-15(13-5-1-2-7-17-13)18-8-4-9-19(11-10-18)16(21)14-6-3-12-22-14/h1-3,5-7,12H,4,8-11H2 |
| InChIKey | AOZOATZXALUQSQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |