C14H14N2O2 — CID 110667356
[3-(furan-2-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 110667356) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is [3-(furan-2-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [3-(furan-2-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110667356 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | [3-(furan-2-yl)pyrrolidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCC(c2ccco2)C1 |
| InChI | InChI=1S/C14H14N2O2/c17-14(12-4-1-2-7-15-12)16-8-6-11(10-16)13-5-3-9-18-13/h1-5,7,9,11H,6,8,10H2 |
| InChIKey | IVRFWYHUZCWNHH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |