C15H17N5O3 — CID 154842455
N'-[4-(furan-2-yl)piperidine-1-carbonyl]pyrimidine-2-carbohydrazide (PubChem CID 154842455) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is N'-[4-(furan-2-yl)piperidine-1-carbonyl]pyrimidine-2-carbohydrazide.
| Compound Name | N'-[4-(furan-2-yl)piperidine-1-carbonyl]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 154842455 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N'-[4-(furan-2-yl)piperidine-1-carbonyl]pyrimidine-2-carbohydrazide |
| SMILES | O=C(NNC(=O)N1CCC(c2ccco2)CC1)c1ncccn1 |
| InChI | InChI=1S/C15H17N5O3/c21-14(13-16-6-2-7-17-13)18-19-15(22)20-8-4-11(5-9-20)12-3-1-10-23-12/h1-3,6-7,10-11H,4-5,8-9H2,(H,18,21)(H,19,22) |
| InChIKey | CTMXYGRIPJVQOF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|