C16H20N6O3 — CID 154851372
3-(furan-2-yl)-N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]pyrrolidine-1-carboxamide (PubChem CID 154851372) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(furan-2-yl)-N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 154851372 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-(furan-2-yl)-N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1n[nH]nc1C(=O)N1CCCC1)N1CCC(c2ccco2)C1 |
| InChI | InChI=1S/C16H20N6O3/c23-15(21-6-1-2-7-21)13-14(19-20-18-13)17-16(24)22-8-5-11(10-22)12-4-3-9-25-12/h3-4,9,11H,1-2,5-8,10H2,(H2,17,18,19,20,24) |
| InChIKey | BZRIKJLPFXYWRD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |