C18H24N6O2 — CID 167842655
N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]-4-pyrrol-1-ylcyclohexane-1-carboxamide (PubChem CID 167842655) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]-4-pyrrol-1-ylcyclohexane-1-carboxamide.
| Compound Name | N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]-4-pyrrol-1-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167842655 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[5-(pyrrolidine-1-carbonyl)-2H-triazol-4-yl]-4-pyrrol-1-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1n[nH]nc1C(=O)N1CCCC1)C1CCC(n2cccc2)CC1 |
| InChI | InChI=1S/C18H24N6O2/c25-17(13-5-7-14(8-6-13)23-9-1-2-10-23)19-16-15(20-22-21-16)18(26)24-11-3-4-12-24/h1-2,9-10,13-14H,3-8,11-12H2,(H2,19,20,21,22,25) |
| InChIKey | QZEKYLMDCAMIRE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |