C9H12N2OS — CID 134368012
(3S)-3-(furan-2-yl)pyrrolidine-1-carbothioamide (PubChem CID 134368012) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is (3S)-3-(furan-2-yl)pyrrolidine-1-carbothioamide.
| Compound Name | (3S)-3-(furan-2-yl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134368012 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3S)-3-(furan-2-yl)pyrrolidine-1-carbothioamide |
| SMILES | NC(=S)N1CC[C@H](c2ccco2)C1 |
| InChI | InChI=1S/C9H12N2OS/c10-9(13)11-4-3-7(6-11)8-2-1-5-12-8/h1-2,5,7H,3-4,6H2,(H2,10,13)/t7-/m0/s1 |
| InChIKey | GBZVISCRGLCCED-ZETCQYMHSA-N |
| XLogP | 1.31 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|