C20H22N4O5 — CID 109083000
[4-(furan-2-carbonyl)piperazin-1-yl]-[2-(morpholine-4-carbonyl)-4-pyridinyl]methanone (PubChem CID 109083000) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)piperazin-1-yl]-[2-(morpholine-4-carbonyl)-4-pyridinyl]methanone.
| Compound Name | [4-(furan-2-carbonyl)piperazin-1-yl]-[2-(morpholine-4-carbonyl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 109083000 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [4-(furan-2-carbonyl)piperazin-1-yl]-[2-(morpholine-4-carbonyl)-4-pyridinyl]methanone |
| SMILES | O=C(c1ccnc(C(=O)N2CCOCC2)c1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H22N4O5/c25-18(22-5-7-23(8-6-22)20(27)17-2-1-11-29-17)15-3-4-21-16(14-15)19(26)24-9-12-28-13-10-24/h1-4,11,14H,5-10,12-13H2 |
| InChIKey | HTLZLEZLSAQJDG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |