C20H25N5O3 — CID 109168568
[4-(furan-2-carbonyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone (PubChem CID 109168568) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone.
| Compound Name | [4-(furan-2-carbonyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 109168568 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [4-(furan-2-carbonyl)piperazin-1-yl]-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methanone |
| SMILES | CN1CCN(c2cc(C(=O)N3CCN(C(=O)c4ccco4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C20H25N5O3/c1-22-6-8-23(9-7-22)18-15-16(4-5-21-18)19(26)24-10-12-25(13-11-24)20(27)17-3-2-14-28-17/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | LGHAETOIQPSTAK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |