C16H17N3O4 — CID 109082801
N-(furan-2-ylmethyl)-4-(morpholine-4-carbonyl)pyridine-2-carboxamide (PubChem CID 109082801) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(morpholine-4-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(morpholine-4-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109082801 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(morpholine-4-carbonyl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccco1)c1cc(C(=O)N2CCOCC2)ccn1 |
| InChI | InChI=1S/C16H17N3O4/c20-15(18-11-13-2-1-7-23-13)14-10-12(3-4-17-14)16(21)19-5-8-22-9-6-19/h1-4,7,10H,5-6,8-9,11H2,(H,18,20) |
| InChIKey | JWKMWNOBKYPKEK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |