C16H21N3O5 — CID 108943477
1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione (PubChem CID 108943477) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione.
| Compound Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 108943477 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-3-morpholin-4-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)N1CCN(C(=O)c2ccco2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C16H21N3O5/c20-14(12-15(21)18-7-10-23-11-8-18)17-3-5-19(6-4-17)16(22)13-2-1-9-24-13/h1-2,9H,3-8,10-12H2 |
| InChIKey | AGASHBZFEDEEGQ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|