C21H27N3O3 — CID 109004649
2-(2,6-diethylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 109004649) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2,6-diethylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109004649 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-(2,6-diethylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CCc1cccc(CC)c1NCC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-3-16-7-5-8-17(4-2)20(16)22-15-19(25)23-10-12-24(13-11-23)21(26)18-9-6-14-27-18/h5-9,14,22H,3-4,10-13,15H2,1-2H3 |
| InChIKey | VZLLQHORVDQNEF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |