C20H25N3O3 — CID 8932507
N-(2-ethyl-6-methylphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 8932507) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8932507 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)CN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H25N3O3/c1-3-16-7-4-6-15(2)19(16)21-18(24)14-22-9-11-23(12-10-22)20(25)17-8-5-13-26-17/h4-8,13H,3,9-12,14H2,1-2H3,(H,21,24) |
| InChIKey | LWINXIGIMPQLAZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |