C17H27N5O3 — CID 119130385
4-(furan-2-carbonyl)-N'-methyl-N-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide (PubChem CID 119130385) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119130385 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-(2-morpholin-4-ylethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN1CCOCC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H27N5O3/c1-18-17(19-4-5-20-10-13-24-14-11-20)22-8-6-21(7-9-22)16(23)15-3-2-12-25-15/h2-3,12H,4-11,13-14H2,1H3,(H,18,19) |
| InChIKey | MLSDEIOXOMVXQX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|