C21H35IN6O4 — CID 111167016
2-[[[4-(furan-2-carbonyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111167016) has the molecular formula C21H35IN6O4 and a molecular weight of 562.45 g/mol. Its IUPAC name is 2-[[[4-(furan-2-carbonyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(furan-2-carbonyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111167016 |
| Molecular Formula | C21H35IN6O4 |
| Molecular Weight | 562.45 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 2-[[[4-(furan-2-carbonyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCN1CCOCC1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C21H34N6O4.HI/c1-24(2)19(28)17-23-21(22-6-4-7-25-12-15-30-16-13-25)27-10-8-26(9-11-27)20(29)18-5-3-14-31-18;/h3,5,14H,4,6-13,15-17H2,1-2H3,(H,22,23);1H |
| InChIKey | PRWIEUPTMTZYCE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.45 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|