C24H41IN6O2 — CID 110048081
2-[[[4-(2,5-dimethylphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110048081) has the molecular formula C24H41IN6O2 and a molecular weight of 572.54 g/mol. Its IUPAC name is 2-[[[4-(2,5-dimethylphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(2,5-dimethylphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110048081 |
| Molecular Formula | C24H41IN6O2 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 2-[[[4-(2,5-dimethylphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1ccc(C)c(N2CCN(/C(=N/CC(=O)N(C)C)NCCCN3CCOCC3)CC2)c1.I |
| InChI | InChI=1S/C24H40N6O2.HI/c1-20-6-7-21(2)22(18-20)29-10-12-30(13-11-29)24(26-19-23(31)27(3)4)25-8-5-9-28-14-16-32-17-15-28;/h6-7,18H,5,8-17,19H2,1-4H3,(H,25,26);1H |
| InChIKey | WFQMVWLOSPWLID-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|