C20H35N7O2 — CID 111741763
N,N-dimethyl-2-[[[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide (PubChem CID 111741763) has the molecular formula C20H35N7O2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111741763 |
| Molecular Formula | C20H35N7O2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCN1CCOCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C20H35N7O2/c1-24(2)19(28)14-22-20(21-6-4-7-26-9-11-29-12-10-26)27-8-5-17(16-27)18-13-23-25(3)15-18/h13,15,17H,4-12,14,16H2,1-3H3,(H,21,22) |
| InChIKey | NHQMRJNOVVQQDW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|