C19H37N5O2S — CID 110044535
N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(2-propan-2-ylthiomorpholin-4-yl)methylidene]amino]acetamide (PubChem CID 110044535) has the molecular formula C19H37N5O2S and a molecular weight of 399.61 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(2-propan-2-ylthiomorpholin-4-yl)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(2-propan-2-ylthiomorpholin-4-yl)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110044535 |
| Molecular Formula | C19H37N5O2S |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | N,N-dimethyl-2-[[(3-morpholin-4-ylpropylamino)-(2-propan-2-ylthiomorpholin-4-yl)methylidene]amino]acetamide |
| SMILES | CC(C)C1CN(/C(=N/CC(=O)N(C)C)NCCCN2CCOCC2)CCS1 |
| InChI | InChI=1S/C19H37N5O2S/c1-16(2)17-15-24(10-13-27-17)19(21-14-18(25)22(3)4)20-6-5-7-23-8-11-26-12-9-23/h16-17H,5-15H2,1-4H3,(H,20,21) |
| InChIKey | SVABTGRRCJHKOO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|