C23H38N6O3 — CID 111243155
2-[[[4-(4-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111243155) has the molecular formula C23H38N6O3 and a molecular weight of 446.60 g/mol. Its IUPAC name is 2-[[[4-(4-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[4-(4-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111243155 |
| Molecular Formula | C23H38N6O3 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2-[[[4-(4-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(N2CCN(/C(=N/CC(=O)N(C)C)NCCCN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C23H38N6O3/c1-26(2)22(30)19-25-23(24-9-4-10-27-15-17-32-18-16-27)29-13-11-28(12-14-29)20-5-7-21(31-3)8-6-20/h5-8H,4,9-19H2,1-3H3,(H,24,25) |
| InChIKey | RJHVIIUWTZZIOS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|