C23H39IN6O3 — CID 111291090
2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111291090) has the molecular formula C23H39IN6O3 and a molecular weight of 574.51 g/mol. Its IUPAC name is 2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111291090 |
| Molecular Formula | C23H39IN6O3 |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 2-[[[4-(3-methoxyphenyl)piperazin-1-yl]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1cccc(N2CCN(/C(=N/CC(=O)N(C)C)NCCCN3CCOCC3)CC2)c1.I |
| InChI | InChI=1S/C23H38N6O3.HI/c1-26(2)22(30)19-25-23(24-8-5-9-27-14-16-32-17-15-27)29-12-10-28(11-13-29)20-6-4-7-21(18-20)31-3;/h4,6-7,18H,5,8-17,19H2,1-3H3,(H,24,25);1H |
| InChIKey | LNSSIJGYAHWFEA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|