C23H39N5O — CID 111290223
4-(3-methoxyphenyl)-N'-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]piperazine-1-carboximidamide (PubChem CID 111290223) has the molecular formula C23H39N5O and a molecular weight of 401.60 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290223 |
| Molecular Formula | C23H39N5O |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCN1CCC(C)CC1)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C23H39N5O/c1-20-9-13-26(14-10-20)12-5-4-11-25-23(24-2)28-17-15-27(16-18-28)21-7-6-8-22(19-21)29-3/h6-8,19-20H,4-5,9-18H2,1-3H3,(H,24,25) |
| InChIKey | FVBQTKYHSJIFEH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|