C21H36N4O3 — CID 111499497
N-[2-(2-butoxyethoxy)ethyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111499497) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[2-(2-butoxyethoxy)ethyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(2-butoxyethoxy)ethyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111499497 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N-[2-(2-butoxyethoxy)ethyl]-4-(3-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCCCOCCOCCN/C(=N\C)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C21H36N4O3/c1-4-5-14-27-16-17-28-15-9-23-21(22-2)25-12-10-24(11-13-25)19-7-6-8-20(18-19)26-3/h6-8,18H,4-5,9-17H2,1-3H3,(H,22,23) |
| InChIKey | ZEBDBZRWTCDRSQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|