C21H37IN4O3 — CID 111499422
N-[2-(2-butoxyethoxy)ethyl]-4-(4-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111499422) has the molecular formula C21H37IN4O3 and a molecular weight of 520.46 g/mol. Its IUPAC name is N-[2-(2-butoxyethoxy)ethyl]-4-(4-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(2-butoxyethoxy)ethyl]-4-(4-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111499422 |
| Molecular Formula | C21H37IN4O3 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-[2-(2-butoxyethoxy)ethyl]-4-(4-methoxyphenyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)N1CCN(c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C21H36N4O3.HI/c1-4-5-15-27-17-18-28-16-10-23-21(22-2)25-13-11-24(12-14-25)19-6-8-20(26-3)9-7-19;/h6-9H,4-5,10-18H2,1-3H3,(H,22,23);1H |
| InChIKey | QNFNGEBVBZEDFE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|