C21H36IN5O — CID 111242058
4-(4-methoxyphenyl)-N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111242058) has the molecular formula C21H36IN5O and a molecular weight of 501.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-methoxyphenyl)-N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111242058 |
| Molecular Formula | C21H36IN5O |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-N'-methyl-N-[2-(1-methylpiperidin-4-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCC1CCN(C)CC1)N1CCN(c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C21H35N5O.HI/c1-22-21(23-11-8-18-9-12-24(2)13-10-18)26-16-14-25(15-17-26)19-4-6-20(27-3)7-5-19;/h4-7,18H,8-17H2,1-3H3,(H,22,23);1H |
| InChIKey | BWRNQJKNPVBYOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|