C15H25IN4O — CID 110961380
N-(2-methoxyethyl)-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110961380) has the molecular formula C15H25IN4O and a molecular weight of 404.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-(2-methoxyethyl)-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110961380 |
| Molecular Formula | C15H25IN4O |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCOC)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C15H24N4O.HI/c1-16-15(17-8-13-20-2)19-11-9-18(10-12-19)14-6-4-3-5-7-14;/h3-7H,8-13H2,1-2H3,(H,16,17);1H |
| InChIKey | ANGLKTFQTNTLAX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|