C21H33IN6O — CID 110960900
N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110960900) has the molecular formula C21H33IN6O and a molecular weight of 512.44 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110960900 |
| Molecular Formula | C21H33IN6O |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methyl-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(CCOC)c1C)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C21H32N6O.HI/c1-17-20(18(2)27(24-17)14-15-28-4)16-23-21(22-3)26-12-10-25(11-13-26)19-8-6-5-7-9-19;/h5-9H,10-16H2,1-4H3,(H,22,23);1H |
| InChIKey | FSLGAHIJUISRHC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|