C18H31N5O3 — CID 111253477
methyl 1-[N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111253477) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl 1-[N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111253477 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | methyl 1-[N-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCc1c(C)nn(CCOC)c1C)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C18H31N5O3/c1-13-16(14(2)23(21-13)10-11-25-4)12-20-18(19-3)22-8-6-15(7-9-22)17(24)26-5/h15H,6-12H2,1-5H3,(H,19,20) |
| InChIKey | ZMHUTJZZDWHCCA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|