C16H31N3O4 — CID 111252633
methyl 1-[N-[4-(2-methoxyethoxy)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252633) has the molecular formula C16H31N3O4 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl 1-[N-[4-(2-methoxyethoxy)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[4-(2-methoxyethoxy)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252633 |
| Molecular Formula | C16H31N3O4 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | methyl 1-[N-[4-(2-methoxyethoxy)butyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(\NCCCCOCCOC)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C16H31N3O4/c1-17-16(18-8-4-5-11-23-13-12-21-2)19-9-6-14(7-10-19)15(20)22-3/h14H,4-13H2,1-3H3,(H,17,18) |
| InChIKey | OSCXMPYQCRYAAB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|