C17H35N3O4 — CID 111745993
N-[4-(2-methoxyethoxy)butyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111745993) has the molecular formula C17H35N3O4 and a molecular weight of 345.48 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)butyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[4-(2-methoxyethoxy)butyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111745993 |
| Molecular Formula | C17H35N3O4 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.26 |
| IUPAC Name | N-[4-(2-methoxyethoxy)butyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCOCCOC)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C17H35N3O4/c1-18-17(19-7-4-5-9-23-12-10-21-2)20-8-6-16(14-20)15-24-13-11-22-3/h16H,4-15H2,1-3H3,(H,18,19) |
| InChIKey | MEOZSJHJWIQMNO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|