C19H39N3O2 — CID 111735103
3-(methoxymethyl)-N'-methyl-N-(3-octoxypropyl)pyrrolidine-1-carboximidamide (PubChem CID 111735103) has the molecular formula C19H39N3O2 and a molecular weight of 341.54 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-(3-octoxypropyl)pyrrolidine-1-carboximidamide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-(3-octoxypropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111735103 |
| Molecular Formula | C19H39N3O2 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-(3-octoxypropyl)pyrrolidine-1-carboximidamide |
| SMILES | CCCCCCCCOCCCN/C(=N\C)N1CCC(COC)C1 |
| InChI | InChI=1S/C19H39N3O2/c1-4-5-6-7-8-9-14-24-15-10-12-21-19(20-2)22-13-11-18(16-22)17-23-3/h18H,4-17H2,1-3H3,(H,20,21) |
| InChIKey | UZFPAEVZDBTASQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|