C13H28IN3O — CID 111737726
3-(methoxymethyl)-N'-methyl-N-pentylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111737726) has the molecular formula C13H28IN3O and a molecular weight of 369.29 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-pentylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-pentylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111737726 |
| Molecular Formula | C13H28IN3O |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-pentylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCCCCN/C(=N\C)N1CCC(COC)C1.I |
| InChI | InChI=1S/C13H27N3O.HI/c1-4-5-6-8-15-13(14-2)16-9-7-12(10-16)11-17-3;/h12H,4-11H2,1-3H3,(H,14,15);1H |
| InChIKey | DTEJLXFMJCHIFV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|