C11H24IN3O3S — CID 119143393
3-(methoxymethyl)-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119143393) has the molecular formula C11H24IN3O3S and a molecular weight of 405.30 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119143393 |
| Molecular Formula | C11H24IN3O3S |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)N1CCC(COC)C1.I |
| InChI | InChI=1S/C11H23N3O3S.HI/c1-12-11(13-5-7-18(3,15)16)14-6-4-10(8-14)9-17-2;/h10H,4-9H2,1-3H3,(H,12,13);1H |
| InChIKey | FTVSHYQUIOXJBB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|