C16H25FIN3O2S — CID 119143609
3-[(4-fluorophenyl)methyl]-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119143609) has the molecular formula C16H25FIN3O2S and a molecular weight of 469.36 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119143609 |
| Molecular Formula | C16H25FIN3O2S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(2-methylsulfonylethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)N1CCC(Cc2ccc(F)cc2)C1.I |
| InChI | InChI=1S/C16H24FN3O2S.HI/c1-18-16(19-8-10-23(2,21)22)20-9-7-14(12-20)11-13-3-5-15(17)6-4-13;/h3-6,14H,7-12H2,1-2H3,(H,18,19);1H |
| InChIKey | LCCYFNSXJCQPCE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|