C21H29FN6 — CID 119143616
3-[(4-fluorophenyl)methyl]-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 119143616) has the molecular formula C21H29FN6 and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119143616 |
| Molecular Formula | C21H29FN6 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1nnc2n1CCCCC2)N1CCC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H29FN6/c1-23-21(24-14-20-26-25-19-5-3-2-4-11-28(19)20)27-12-10-17(15-27)13-16-6-8-18(22)9-7-16/h6-9,17H,2-5,10-15H2,1H3,(H,23,24) |
| InChIKey | CVRICWGJLSLJPQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|