C17H21FN4S — CID 119143612
3-[(4-fluorophenyl)methyl]-N'-methyl-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 119143612) has the molecular formula C17H21FN4S and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119143612 |
| Molecular Formula | C17H21FN4S |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N'-methyl-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nccs1)N1CCC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H21FN4S/c1-19-17(21-11-16-20-7-9-23-16)22-8-6-14(12-22)10-13-2-4-15(18)5-3-13/h2-5,7,9,14H,6,8,10-12H2,1H3,(H,19,21) |
| InChIKey | DASAMLLWMVYXGT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|