C16H21FIN5S — CID 119130141
4-(2-fluorophenyl)-N'-methyl-N-(1,3-thiazol-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119130141) has the molecular formula C16H21FIN5S and a molecular weight of 461.35 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-(1,3-thiazol-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-(1,3-thiazol-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130141 |
| Molecular Formula | C16H21FIN5S |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-(1,3-thiazol-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nccs1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C16H20FN5S.HI/c1-18-16(20-12-15-19-6-11-23-15)22-9-7-21(8-10-22)14-5-3-2-4-13(14)17;/h2-6,11H,7-10,12H2,1H3,(H,18,20);1H |
| InChIKey | FXWKFMQWEISOAJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|