C23H31FIN5O — CID 111148524
4-(2-fluorophenyl)-N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111148524) has the molecular formula C23H31FIN5O and a molecular weight of 539.44 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-fluorophenyl)-N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111148524 |
| Molecular Formula | C23H31FIN5O |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4-(2-fluorophenyl)-N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1N1CCOCC1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C23H30FN5O.HI/c1-25-23(29-12-10-27(11-13-29)22-9-5-3-7-20(22)24)26-18-19-6-2-4-8-21(19)28-14-16-30-17-15-28;/h2-9H,10-18H2,1H3,(H,25,26);1H |
| InChIKey | HMXATULSCKVTOC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|