C21H26N4O — CID 110983986
N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 110983986) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110983986 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1N1CCOCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H26N4O/c1-22-21(25-11-10-17-6-2-5-9-20(17)25)23-16-18-7-3-4-8-19(18)24-12-14-26-15-13-24/h2-9H,10-16H2,1H3,(H,22,23) |
| InChIKey | QRPHLBUYYMWOEO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|