C19H21FIN3O2 — CID 119116479
N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 119116479) has the molecular formula C19H21FIN3O2 and a molecular weight of 469.30 g/mol. Its IUPAC name is N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119116479 |
| Molecular Formula | C19H21FIN3O2 |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cc(F)cc2c1OCOC2)N1CCc2ccccc21.I |
| InChI | InChI=1S/C19H20FN3O2.HI/c1-21-19(23-7-6-13-4-2-3-5-17(13)23)22-10-14-8-16(20)9-15-11-24-12-25-18(14)15;/h2-5,8-9H,6-7,10-12H2,1H3,(H,21,22);1H |
| InChIKey | CLBGTLLDEDSLHJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|