C22H26ClFN4O2 — CID 111177724
4-(2-chlorophenyl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111177724) has the molecular formula C22H26ClFN4O2 and a molecular weight of 432.93 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177724 |
| Molecular Formula | C22H26ClFN4O2 |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H26ClFN4O2/c1-25-22(28-10-8-27(9-11-28)20-5-3-2-4-19(20)23)26-7-6-16-12-18(24)13-17-14-29-15-30-21(16)17/h2-5,12-13H,6-11,14-15H2,1H3,(H,25,26) |
| InChIKey | VBFGZCASGNKESQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|