C23H26FN3O2 — CID 111263513
N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 111263513) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 111263513 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26FN3O2/c1-25-23(27-11-8-18(9-12-27)17-5-3-2-4-6-17)26-10-7-19-13-21(24)14-20-15-28-16-29-22(19)20/h2-6,8,13-14H,7,9-12,15-16H2,1H3,(H,25,26) |
| InChIKey | UWFHNJKRDKDHNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|