C21H27FIN3O2 — CID 111199169
1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide (PubChem CID 111199169) has the molecular formula C21H27FIN3O2 and a molecular weight of 499.37 g/mol. Its IUPAC name is 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111199169 |
| Molecular Formula | C21H27FIN3O2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 1-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methyl-3-(3-phenylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccccc1)NCCc1cc(F)cc2c1OCOC2.I |
| InChI | InChI=1S/C21H26FN3O2.HI/c1-23-21(24-10-5-8-16-6-3-2-4-7-16)25-11-9-17-12-19(22)13-18-14-26-15-27-20(17)18;/h2-4,6-7,12-13H,5,8-11,14-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | RSUUWGLYEFPDPE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|