C18H28FN3O3 — CID 111945669
1-(4-ethoxybutyl)-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methylguanidine (PubChem CID 111945669) has the molecular formula C18H28FN3O3 and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-(4-ethoxybutyl)-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-(4-ethoxybutyl)-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111945669 |
| Molecular Formula | C18H28FN3O3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-(4-ethoxybutyl)-3-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-2-methylguanidine |
| SMILES | CCOCCCCN/C(=N\C)NCCc1cc(F)cc2c1OCOC2 |
| InChI | InChI=1S/C18H28FN3O3/c1-3-23-9-5-4-7-21-18(20-2)22-8-6-14-10-16(19)11-15-12-24-13-25-17(14)15/h10-11H,3-9,12-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | OMRFHCKSEQIMGD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|