C18H27FIN3O2S — CID 109487946
N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109487946) has the molecular formula C18H27FIN3O2S and a molecular weight of 495.40 g/mol. Its IUPAC name is N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109487946 |
| Molecular Formula | C18H27FIN3O2S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C18H26FN3O2S.HI/c1-18(2)11-22(6-7-25-18)17(20-3)21-5-4-13-8-15(19)9-14-10-23-12-24-16(13)14;/h8-9H,4-7,10-12H2,1-3H3,(H,20,21);1H |
| InChIKey | VIUWPMDKQOUAEW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|