C20H31FIN3O4 — CID 111746380
N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746380) has the molecular formula C20H31FIN3O4 and a molecular weight of 523.39 g/mol. Its IUPAC name is N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746380 |
| Molecular Formula | C20H31FIN3O4 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-3-(2-methoxyethoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(F)cc2c1OCOC2)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C20H30FN3O4.HI/c1-22-20(24-6-4-15(11-24)12-26-8-7-25-2)23-5-3-16-9-18(21)10-17-13-27-14-28-19(16)17;/h9-10,15H,3-8,11-14H2,1-2H3,(H,22,23);1H |
| InChIKey | OKNTTZIGMSGRPU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|