C26H35N5O — CID 111218785
N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide (PubChem CID 111218785) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111218785 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N'-methyl-N-[(2-morpholin-4-ylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccccc1N1CCOCC1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N5O/c1-27-26(28-22-24-11-5-6-12-25(24)30-18-20-32-21-19-30)31-16-14-29(15-17-31)13-7-10-23-8-3-2-4-9-23/h2-12H,13-22H2,1H3,(H,27,28)/b10-7+ |
| InChIKey | YYJIORYHTWZJAB-JXMROGBWSA-N |
| XLogP | 2.93 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|