C17H26FN5O — CID 111148259
3-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 111148259) has the molecular formula C17H26FN5O and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111148259 |
| Molecular Formula | C17H26FN5O |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H26FN5O/c1-19-17(20-9-8-16(24)21(2)3)23-12-10-22(11-13-23)15-7-5-4-6-14(15)18/h4-7H,8-13H2,1-3H3,(H,19,20) |
| InChIKey | BMHYXTGZSBZTMX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|