C20H23F2N5O — CID 111148741
N-(4-fluorophenyl)-2-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetamide (PubChem CID 111148741) has the molecular formula C20H23F2N5O and a molecular weight of 387.43 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111148741 |
| Molecular Formula | C20H23F2N5O |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H23F2N5O/c1-23-20(24-14-19(28)25-16-8-6-15(21)7-9-16)27-12-10-26(11-13-27)18-5-3-2-4-17(18)22/h2-9H,10-14H2,1H3,(H,23,24)(H,25,28) |
| InChIKey | XJBRCLRNBFLDES-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|