C21H27FIN5O2 — CID 111148975
methyl N-[4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111148975) has the molecular formula C21H27FIN5O2 and a molecular weight of 527.38 g/mol. Its IUPAC name is methyl N-[4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111148975 |
| Molecular Formula | C21H27FIN5O2 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | methyl N-[4-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)OC)cc1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C21H26FN5O2.HI/c1-23-20(24-15-16-7-9-17(10-8-16)25-21(28)29-2)27-13-11-26(12-14-27)19-6-4-3-5-18(19)22;/h3-10H,11-15H2,1-2H3,(H,23,24)(H,25,28);1H |
| InChIKey | PLLQCQQSIBFXBF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|