C24H27FIN5O2 — CID 111148340
N-[3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111148340) has the molecular formula C24H27FIN5O2 and a molecular weight of 563.42 g/mol. Its IUPAC name is N-[3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111148340 |
| Molecular Formula | C24H27FIN5O2 |
| Molecular Weight | 563.42 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | N-[3-[[[C-[4-(2-fluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)c2ccco2)c1)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C24H26FN5O2.HI/c1-26-24(30-13-11-29(12-14-30)21-9-3-2-8-20(21)25)27-17-18-6-4-7-19(16-18)28-23(31)22-10-5-15-32-22;/h2-10,15-16H,11-14,17H2,1H3,(H,26,27)(H,28,31);1H |
| InChIKey | DRBBTDZHSPEVOL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|